ChemNet > CAS > 2234-14-2 2',4',6'-Triisopropylacetophenone
2234-14-2 2',4',6'-Triisopropylacetophenone
| product Name |
2',4',6'-Triisopropylacetophenone |
| CAS No |
2234-14-2 |
| Synonyms |
2,4,6-Triisopropylacetophenone; 1-[2,4,6-tri(propan-2-yl)phenyl]ethanone |
| Molecular Formula |
C17H26O |
| Molecular Weight |
246.3877 |
| InChI |
InChI=1/C17H26O/c1-10(2)14-8-15(11(3)4)17(13(7)18)16(9-14)12(5)6/h8-12H,1-7H3 |
| EINECS |
218-779-2 |
| Molecular Structure |
|
| Density |
0.908g/cm3 |
| Melting point |
84℃ |
| Boiling point |
329.9°C at 760 mmHg |
| Refractive index |
1.493 |
| Flash point |
135.8°C |
| Vapour Pressur |
0.000172mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
