ChemNet > CAS > 2234-75-5 1,2,4-trimethylcyclohexane mixture of isomers
2234-75-5 1,2,4-trimethylcyclohexane mixture of isomers
| product Name |
1,2,4-trimethylcyclohexane mixture of isomers |
| CAS No |
2234-75-5 |
| Synonyms |
1,2,4-Trimethylcyclohexane |
| Molecular Formula |
C9H18 |
| Molecular Weight |
126.2392 |
| InChI |
InChI=1/C9H18/c1-7-4-5-8(2)9(3)6-7/h7-9H,4-6H2,1-3H3 |
| EINECS |
218-783-4 |
| Molecular Structure |
|
| Density |
0.758g/cm3 |
| Boiling point |
143.5°C at 760 mmHg |
| Refractive index |
1.416 |
| Flash point |
27.9°C |
| Vapour Pressur |
6.69mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
