ChemNet > CAS > 223671-15-6 7-Bromo-1-hydroxyisoquinoline
223671-15-6 7-Bromo-1-hydroxyisoquinoline
| product Name |
7-Bromo-1-hydroxyisoquinoline |
| CAS No |
223671-15-6 |
| Synonyms |
7-Bromoisocarbostyril; 7-bromoisoquinolin-1(2H)-one; 7-bromo-1(2H)-isoquinolone |
| Molecular Formula |
C9H6BrNO |
| Molecular Weight |
224.054 |
| InChI |
InChI=1/C9H6BrNO/c10-7-2-1-6-3-4-11-9(12)8(6)5-7/h1-5H,(H,11,12) |
| Molecular Structure |
|
| Density |
1.62g/cm3 |
| Boiling point |
427.5°C at 760 mmHg |
| Refractive index |
1.63 |
| Flash point |
212.4°C |
| Vapour Pressur |
1.63E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
