ChemNet > CAS > 2243-32-5 2,3,4,5,6-pentamethylbenzoic acid
2243-32-5 2,3,4,5,6-pentamethylbenzoic acid
| product Name |
2,3,4,5,6-pentamethylbenzoic acid |
| CAS No |
2243-32-5 |
| Synonyms |
Pentamethylbenzoic acid |
| Molecular Formula |
C12H16O2 |
| Molecular Weight |
192.2542 |
| InChI |
InChI=1/C12H16O2/c1-6-7(2)9(4)11(12(13)14)10(5)8(6)3/h1-5H3,(H,13,14) |
| EINECS |
218-809-4 |
| Molecular Structure |
|
| Density |
1.048g/cm3 |
| Boiling point |
341.2°C at 760 mmHg |
| Refractive index |
1.537 |
| Flash point |
159.7°C |
| Vapour Pressur |
3.15E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
