ChemNet > CAS > 2243-42-7 2-Phenoxybenzoic acid
2243-42-7 2-Phenoxybenzoic acid
| product Name |
2-Phenoxybenzoic acid |
| CAS No |
2243-42-7 |
| Synonyms |
2-Carboxydiphenyl ether; 2-phenoxybenzoate |
| Molecular Formula |
C13H9O3 |
| Molecular Weight |
213.2093 |
| InChI |
InChI=1/C13H10O3/c14-13(15)11-8-4-5-9-12(11)16-10-6-2-1-3-7-10/h1-9H,(H,14,15)/p-1 |
| EINECS |
218-811-5 |
| Molecular Structure |
|
| Melting point |
111-115℃ |
| Boiling point |
343.3°C at 760 mmHg |
| Flash point |
132°C |
| Vapour Pressur |
2.73E-05mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
