ChemNet > CAS > 2243-81-4 1-Naphthalenecarboxamide
2243-81-4 1-Naphthalenecarboxamide
| product Name |
1-Naphthalenecarboxamide |
| CAS No |
2243-81-4 |
| Synonyms |
Naphthalene-1-carboxamide |
| Molecular Formula |
C11H9NO |
| Molecular Weight |
171.1953 |
| InChI |
InChI=1/C11H9NO/c12-11(13)10-7-3-5-8-4-1-2-6-9(8)10/h1-7H,(H2,12,13) |
| Molecular Structure |
|
| Density |
1.203g/cm3 |
| Boiling point |
401.5°C at 760 mmHg |
| Refractive index |
1.668 |
| Flash point |
196.6°C |
| Vapour Pressur |
1.18E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
