ChemNet > CAS > 2243-82-5 Naphthalene-2-carboxamide
2243-82-5 Naphthalene-2-carboxamide
| product Name |
Naphthalene-2-carboxamide |
| CAS No |
2243-82-5 |
| Synonyms |
2-Naphthylamide |
| Molecular Formula |
C11H9NO |
| Molecular Weight |
171.1953 |
| InChI |
InChI=1/C11H9NO/c12-11(13)10-6-5-8-3-1-2-4-9(8)7-10/h1-7H,(H2,12,13) |
| EINECS |
218-820-4 |
| Molecular Structure |
|
| Density |
1.203g/cm3 |
| Boiling point |
401.5°C at 760 mmHg |
| Refractive index |
1.668 |
| Flash point |
196.6°C |
| Vapour Pressur |
1.18E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
