ChemNet > CAS > 2245-38-7 2,3,5-Trimethylnaphthalene
2245-38-7 2,3,5-Trimethylnaphthalene
| product Name |
2,3,5-Trimethylnaphthalene |
| CAS No |
2245-38-7 |
| Synonyms |
1,6,7-Trimethylnaphthalene |
| Molecular Formula |
C13H14 |
| Molecular Weight |
170.2503 |
| InChI |
InChI=1/C13H14/c1-9-5-4-6-12-7-10(2)11(3)8-13(9)12/h4-8H,1-3H3 |
| EINECS |
218-833-5 |
| Molecular Structure |
|
| Density |
0.987g/cm3 |
| Boiling point |
286.8°C at 760 mmHg |
| Refractive index |
1.594 |
| Flash point |
127.8°C |
| Vapour Pressur |
0.00445mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
