ChemNet > CAS > 2254-94-6 N-Methylbenzothiazole-2-thione
2254-94-6 N-Methylbenzothiazole-2-thione
| product Name |
N-Methylbenzothiazole-2-thione |
| CAS No |
2254-94-6 |
| Synonyms |
3-Methylbenzothiazole-2-thione; 3-methyl-1,3-benzothiazole-2(3H)-thione |
| Molecular Formula |
C8H7NS2 |
| Molecular Weight |
181.2779 |
| InChI |
InChI=1/C8H7NS2/c1-9-6-4-2-3-5-7(6)11-8(9)10/h2-5H,1H3 |
| EINECS |
218-852-9 |
| Molecular Structure |
|
| Density |
1.39g/cm3 |
| Melting point |
88-91℃ |
| Boiling point |
300.6°C at 760 mmHg |
| Refractive index |
1.753 |
| Flash point |
135.6°C |
| Vapour Pressur |
0.00111mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
