ChemNet > CAS > 2257-69-4 4-chloro-1,2-dihydrophthalazin-1-one
2257-69-4 4-chloro-1,2-dihydrophthalazin-1-one
| product Name |
4-chloro-1,2-dihydrophthalazin-1-one |
| CAS No |
2257-69-4 |
| Synonyms |
1-Chloro-3,4-dihydrophthalazin-4-one; 4-chlorophthalazin-1(2H)-one |
| Molecular Formula |
C8H5ClN2O |
| Molecular Weight |
180.5911 |
| InChI |
InChI=1/C8H5ClN2O/c9-7-5-3-1-2-4-6(5)8(12)11-10-7/h1-4H,(H,11,12) |
| Molecular Structure |
|
| Density |
1.5g/cm3 |
| Melting point |
265℃ |
| Boiling point |
452.7°C at 760 mmHg |
| Refractive index |
1.688 |
| Flash point |
227.6°C |
| Vapour Pressur |
8.2E-09mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
