ChemNet > CAS > 226396-32-3 2,3,4-Trifluorophenylboronic acid
226396-32-3 2,3,4-Trifluorophenylboronic acid
| product Name |
2,3,4-Trifluorophenylboronic acid |
| CAS No |
226396-32-3 |
| Molecular Formula |
C6H4BF3O2 |
| Molecular Weight |
175.901 |
| InChI |
InChI=1/C6H4BF3O2/c8-4-2-1-3(7(11)12)5(9)6(4)10/h1-2,11-12H |
| Molecular Structure |
|
| Density |
1.44g/cm3 |
| Melting point |
229-235℃ |
| Boiling point |
260.2°C at 760 mmHg |
| Refractive index |
1.465 |
| Flash point |
111.2°C |
| Vapour Pressur |
0.00629mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
