ChemNet > CAS > 2265-91-0 1,3-Difluoro-5-iodobenzene
2265-91-0 1,3-Difluoro-5-iodobenzene
| product Name |
1,3-Difluoro-5-iodobenzene |
| CAS No |
2265-91-0 |
| Synonyms |
3,5-DIFLUOROIODOBENZENE; 3,5-Difluoro iodobenzene |
| Molecular Formula |
C6H3F2I |
| Molecular Weight |
239.9893 |
| InChI |
InChI=1/C6H3F2I/c7-4-1-5(8)3-6(9)2-4/h1-3H |
| Molecular Structure |
|
| Density |
2.001g/cm3 |
| Boiling point |
173.9°C at 760 mmHg |
| Refractive index |
1.566 |
| Flash point |
63.8°C |
| Vapour Pressur |
1.66mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
