ChemNet > CAS > 2270-59-9 5-Bromo-2-methyl-2-pentene
2270-59-9 5-Bromo-2-methyl-2-pentene
| product Name |
5-Bromo-2-methyl-2-pentene |
| CAS No |
2270-59-9 |
| Synonyms |
5-bromo-2-methylpent-2-ene |
| Molecular Formula |
C6H11Br |
| Molecular Weight |
163.0555 |
| InChI |
InChI=1/C6H11Br/c1-6(2)4-3-5-7/h4H,3,5H2,1-2H3 |
| Molecular Structure |
|
| Density |
1.215g/cm3 |
| Boiling point |
152.6°C at 760 mmHg |
| Refractive index |
1.47 |
| Flash point |
22.8°C |
| Vapour Pressur |
4.44mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
