ChemNet > CAS > 2274-89-7 5-chloro-4-nitro-2,1,3-benzothiadiazole
2274-89-7 5-chloro-4-nitro-2,1,3-benzothiadiazole
| product Name |
5-chloro-4-nitro-2,1,3-benzothiadiazole |
| CAS No |
2274-89-7 |
| Synonyms |
5-Chloro-4-(hydroxy(oxido)amino)-2,1,3-benzothiadiazole; NSC 202425 |
| Molecular Formula |
C6H2ClN3O2S |
| Molecular Weight |
215.617 |
| InChI |
InChI=1/C6H2ClN3O2S/c7-3-1-2-4-5(9-13-8-4)6(3)10(11)12/h1-2H |
| Molecular Structure |
|
| Density |
1.749g/cm3 |
| Melting point |
149℃ |
| Boiling point |
348.8°C at 760 mmHg |
| Refractive index |
1.747 |
| Flash point |
164.7°C |
| Vapour Pressur |
9.9E-05mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
