ChemNet > CAS > 22921-67-1 5-Acetamido-2-bromobenzoic acid hydrate
22921-67-1 5-Acetamido-2-bromobenzoic acid hydrate
| product Name |
5-Acetamido-2-bromobenzoic acid hydrate |
| CAS No |
22921-67-1 |
| Synonyms |
5-(acetylamino)-2-bromobenzoic acid; 5-(acetylamino)-2-bromobenzoate |
| Molecular Formula |
C9H7BrNO3 |
| Molecular Weight |
257.0613 |
| InChI |
InChI=1/C9H8BrNO3/c1-5(12)11-6-2-3-8(10)7(4-6)9(13)14/h2-4H,1H3,(H,11,12)(H,13,14)/p-1 |
| Molecular Structure |
|
| Melting point |
186℃ |
| Boiling point |
466°C at 760 mmHg |
| Flash point |
235.6°C |
| Vapour Pressur |
1.75E-09mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
| MSDS |
Material Safety Data Sheet
|
|
