ChemNet > CAS > 22921-68-2 2-Bromo-5-methoxybenzoic acid
22921-68-2 2-Bromo-5-methoxybenzoic acid
| product Name |
2-Bromo-5-methoxybenzoic acid |
| CAS No |
22921-68-2 |
| Synonyms |
6-Bromo-m-anisic acid; 2-bromo-5-methoxybenzoate |
| Molecular Formula |
C8H6BrO3 |
| Molecular Weight |
230.036 |
| InChI |
InChI=1/C8H7BrO3/c1-12-5-2-3-7(9)6(4-5)8(10)11/h2-4H,1H3,(H,10,11)/p-1 |
| EINECS |
245-329-2 |
| Molecular Structure |
|
| Melting point |
158-159℃ |
| Boiling point |
337.8°C at 760 mmHg |
| Flash point |
158.1°C |
| Vapour Pressur |
4E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
