ChemNet > CAS > 2293-07-4 1-(4-methoxyphenyl)-2-thiourea
2293-07-4 1-(4-methoxyphenyl)-2-thiourea
| product Name |
1-(4-methoxyphenyl)-2-thiourea |
| CAS No |
2293-07-4 |
| Synonyms |
4-Methoxyphenylthiourea; 1-(4-methoxyphenyl)thiourea |
| Molecular Formula |
C8H10N2OS |
| Molecular Weight |
182.2428 |
| InChI |
InChI=1/C8H10N2OS/c1-11-7-4-2-6(3-5-7)10-8(9)12/h2-5H,1H3,(H3,9,10,12) |
| EINECS |
218-931-8 |
| Molecular Structure |
|
| Density |
1.287g/cm3 |
| Melting point |
212℃ |
| Boiling point |
311°C at 760 mmHg |
| Refractive index |
1.677 |
| Flash point |
141.9°C |
| Vapour Pressur |
0.00058mmHg at 25°C |
| Hazard Symbols |
 T:Toxic;
|
| Risk Codes |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S38:In case of insufficient ventilation, wear suitable respiratory equipment.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
| MSDS |
Material Safety Data Sheet
|
|
