ChemNet > CAS > 2298-13-7 4-o-tolylazo-o-toluidinium chloride
2298-13-7 4-o-tolylazo-o-toluidinium chloride
| product Name |
4-o-tolylazo-o-toluidinium chloride |
| CAS No |
2298-13-7 |
| Synonyms |
C.I. Solvent Yellow 3 monohydrochloride; C.I. Solvent Yellow 3, monohydrochloride (8CI); 4-Amino-2,3-dimethylazobenzene hydrochloride; p-Amino-2,3-azotoluene hydrochloride~C.I. 37210~Fast Garnet GBC hydrochloride; 2-methyl-4-[(E)-(2-methylphenyl)diazenyl]aniline hydrochloride (1:1) |
| Molecular Formula |
C14H16ClN3 |
| Molecular Weight |
261.7499 |
| InChI |
InChI=1/C14H15N3.ClH/c1-10-5-3-4-6-14(10)17-16-12-7-8-13(15)11(2)9-12;/h3-9H,15H2,1-2H3;1H/b17-16+; |
| EINECS |
218-945-4 |
| Molecular Structure |
|
| Boiling point |
407.7°C at 760 mmHg |
| Flash point |
200.4°C |
| Vapour Pressur |
7.42E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R40:Possible risks of irreversible effects.;
|
| Safety Description |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
