ChemNet > CAS > 2305-26-2 Cyclohexenedicarboxylicacid
2305-26-2 Cyclohexenedicarboxylicacid
| product Name |
Cyclohexenedicarboxylicacid |
| CAS No |
2305-26-2 |
| Synonyms |
(1R,2S)-Cyclohex-4-ene-1,2-dicarboxylic acid; 4-cyclohexene-1,2-dicarboxylic acid, (1R,2S)-; 4-Cyclohexene-1,2-dicarboxylic acid, (1R,2S)-rel-; 4-Cyclohexene-1,2-dicarboxylic acid, cis-; Cis-4-cyclohexene-1,2-dicarboxylic acid |
| Molecular Formula |
C8H10O4 |
| Molecular Weight |
170.1626 |
| InChI |
InChI=1/C8H10O4/c9-7(10)5-3-1-2-4-6(5)8(11)12/h1-2,5-6H,3-4H2,(H,9,10)(H,11,12)/t5-,6+ |
| EINECS |
218-974-2 |
| Molecular Structure |
|
| Density |
1.369g/cm3 |
| Boiling point |
395.4°C at 760 mmHg |
| Refractive index |
1.548 |
| Flash point |
207.1°C |
| Vapour Pressur |
2.36E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
