ChemNet > CAS > 2305-79-5 4,5,6,7-tetrahydroindazole
2305-79-5 4,5,6,7-tetrahydroindazole
| product Name |
4,5,6,7-tetrahydroindazole |
| CAS No |
2305-79-5 |
| Synonyms |
4,5,6,7-Tetrahydro-1H-indazole |
| Molecular Formula |
C7H10N2 |
| Molecular Weight |
122.1677 |
| InChI |
InChI=1/C7H10N2/c1-2-4-7-6(3-1)5-8-9-7/h5H,1-4H2,(H,8,9) |
| EINECS |
218-977-9 |
| Molecular Structure |
|
| Density |
1.133g/cm3 |
| Melting point |
83-85℃ |
| Boiling point |
291.5°C at 760 mmHg |
| Refractive index |
1.573 |
| Flash point |
139.2°C |
| Vapour Pressur |
0.00339mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
