ChemNet > CAS > 2307-10-0 S-n-Propyl thioacetate
2307-10-0 S-n-Propyl thioacetate
| product Name |
S-n-Propyl thioacetate |
| CAS No |
2307-10-0 |
| Synonyms |
Thioacetic acid S-n-propyl ester; S-propyl ethanethioate; Propyl thioacetate |
| Molecular Formula |
C5H10OS |
| Molecular Weight |
118.1973 |
| InChI |
InChI=1/C5H10OS/c1-3-4-7-5(2)6/h3-4H2,1-2H3 |
| EINECS |
218-984-7 |
| Molecular Structure |
|
| Density |
0.967g/cm3 |
| Boiling point |
141.4°C at 760 mmHg |
| Refractive index |
1.456 |
| Flash point |
36°C |
| Vapour Pressur |
5.87mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R10:Flammable.;
|
| Safety Description |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|
