ChemNet > CAS > 2309-48-0 1,3-Di-2-thienyl-2-propen-1-one
2309-48-0 1,3-Di-2-thienyl-2-propen-1-one
| product Name |
1,3-Di-2-thienyl-2-propen-1-one |
| CAS No |
2309-48-0 |
| Synonyms |
1,3-di(thiophen-2-yl)prop-2-en-1-one; (2E)-1,3-dithiophen-2-ylprop-2-en-1-one |
| Molecular Formula |
C11H8OS2 |
| Molecular Weight |
220.3106 |
| InChI |
InChI=1/C11H8OS2/c12-10(11-4-2-8-14-11)6-5-9-3-1-7-13-9/h1-8H/b6-5+ |
| EINECS |
218-993-6 |
| Molecular Structure |
|
| Density |
1.305g/cm3 |
| Boiling point |
365.1°C at 760 mmHg |
| Refractive index |
1.681 |
| Flash point |
174.6°C |
| Vapour Pressur |
1.61E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
