ChemNet > CAS > 23138-64-9 3-Acetylphenyl isocyanate
23138-64-9 3-Acetylphenyl isocyanate
| product Name |
3-Acetylphenyl isocyanate |
| CAS No |
23138-64-9 |
| Synonyms |
3-Isocyanatoacetophenone; 1-(3-isocyanatophenyl)ethanone |
| Molecular Formula |
C9H7NO2 |
| Molecular Weight |
161.1574 |
| InChI |
InChI=1/C9H7NO2/c1-7(12)8-3-2-4-9(5-8)10-6-11/h2-5H,1H3 |
| Molecular Structure |
|
| Density |
1.09g/cm3 |
| Melting point |
33-34℃ |
| Boiling point |
271.1°C at 760 mmHg |
| Refractive index |
1.537 |
| Flash point |
108.8°C |
| Vapour Pressur |
0.00658mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
