ChemNet > CAS > 2315-86-8 3-Bromo-4-hydroxybenzonitrile
2315-86-8 3-Bromo-4-hydroxybenzonitrile
| product Name |
3-Bromo-4-hydroxybenzonitrile |
| CAS No |
2315-86-8 |
| Synonyms |
2-Bromo-4-cyanophenol |
| Molecular Formula |
C7H4BrNO |
| Molecular Weight |
198.0168 |
| InChI |
InChI=1/C7H4BrNO/c8-6-3-5(4-9)1-2-7(6)10/h1-3,10H |
| EINECS |
219-022-9 |
| Molecular Structure |
|
| Density |
1.79g/cm3 |
| Melting point |
155℃ |
| Boiling point |
271.1°C at 760 mmHg |
| Refractive index |
1.656 |
| Flash point |
117.8°C |
| Vapour Pressur |
0.00396mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S36/37:Wear suitable protective clothing and gloves.;
|
| MSDS |
Material Safety Data Sheet
|
|
