ChemNet > CAS > 23279-22-3 3-Amino-L-tyrosine dihydrochloride monohydrate
23279-22-3 3-Amino-L-tyrosine dihydrochloride monohydrate
| product Name |
3-Amino-L-tyrosine dihydrochloride monohydrate |
| CAS No |
23279-22-3 |
| Synonyms |
3-Amino-Tyrosine-2 Hcl; H-Tyr(3-NH2)-OH・2HCl |
| Molecular Formula |
C9H16Cl2N2O4 |
| Molecular Weight |
287.1403 |
| InChI |
InChI=1/C9H12N2O3.2ClH.H2O/c10-6-3-5(1-2-8(6)12)4-7(11)9(13)14;;;/h1-3,7,12H,4,10-11H2,(H,13,14);2*1H;1H2 |
| EINECS |
245-552-5 |
| Molecular Structure |
|
| Melting point |
158-160℃ |
| Boiling point |
427.9°C at 760 mmHg |
| Flash point |
212.6°C |
| Vapour Pressur |
4.38E-08mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
