ChemNet > CAS > 23351-91-9 5-Bromoisophthalic acid
23351-91-9 5-Bromoisophthalic acid
| product Name |
5-Bromoisophthalic acid |
| CAS No |
23351-91-9 |
| Synonyms |
1,3-Benzenedicarboxylic acid, 5-bromo-; 5-bromobenzene-1,3-dicarboxylic acid; 5-bromobenzene-1,3-dicarboxylate; 5-Bromo-1,3-benzenedicarboxyicacid; 5-bromo-1,3-benzenedicarboxylic acid |
| Molecular Formula |
C8H3BrO4 |
| Molecular Weight |
243.0121 |
| InChI |
InChI=1/C8H5BrO4/c9-6-2-4(7(10)11)1-5(3-6)8(12)13/h1-3H,(H,10,11)(H,12,13)/p-2 |
| EINECS |
245-602-6 |
| Molecular Structure |
|
| Melting point |
276-287℃ |
| Boiling point |
452.1°C at 760 mmHg |
| Flash point |
227.2°C |
| Vapour Pressur |
5.8E-09mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
