ChemNet > CAS > 2338-71-8 5-fluoroindole-3-carboxaldehyde
2338-71-8 5-fluoroindole-3-carboxaldehyde
| product Name |
5-fluoroindole-3-carboxaldehyde |
| CAS No |
2338-71-8 |
| Synonyms |
5-Fluoro-3-formylindole; 5-fluoro-1H-indole-3-carbaldehyde |
| Molecular Formula |
C9H6FNO |
| Molecular Weight |
163.1484 |
| InChI |
InChI=1/C9H6FNO/c10-7-1-2-9-8(3-7)6(5-12)4-11-9/h1-5,11H |
| Molecular Structure |
|
| Density |
1.385g/cm3 |
| Boiling point |
342.4°C at 760 mmHg |
| Refractive index |
1.695 |
| Flash point |
160.9°C |
| Vapour Pressur |
7.53E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
