ChemNet > CAS > 2349-58-8 4,5-Diphenyl-2-imidazolethiol
2349-58-8 4,5-Diphenyl-2-imidazolethiol
| product Name |
4,5-Diphenyl-2-imidazolethiol |
| CAS No |
2349-58-8 |
| Synonyms |
2,3-Diphenyl-1-indenone; 4,5-diphenyl-1,3-dihydro-2H-imidazole-2-thione |
| Molecular Formula |
C15H12N2S |
| Molecular Weight |
252.3342 |
| InChI |
InChI=1/C15H12N2S/c18-15-16-13(11-7-3-1-4-8-11)14(17-15)12-9-5-2-6-10-12/h1-10H,(H2,16,17,18) |
| EINECS |
219-077-9 |
| Molecular Structure |
|
| Density |
1.29g/cm3 |
| Melting point |
300℃ |
| Boiling point |
407.5°C at 760 mmHg |
| Refractive index |
1.724 |
| Flash point |
200.3°C |
| Vapour Pressur |
7.51E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
