2350-89-2 4-Vinylbiphenyl
product Name |
4-Vinylbiphenyl |
CAS No |
2350-89-2 |
Synonyms |
4-Phenylstyrene; 4-ethenylbiphenyl |
Molecular Formula |
C14H12 |
Molecular Weight |
180.2451 |
InChI |
InChI=1/C14H12/c1-2-12-8-10-14(11-9-12)13-6-4-3-5-7-13/h2-11H,1H2 |
EINECS |
219-082-6 |
Molecular Structure |
|
Density |
0.997g/cm3 |
Melting point |
115-121℃ |
Boiling point |
301.7°C at 760 mmHg |
Refractive index |
1.599 |
Flash point |
139.4°C |
Vapour Pressur |
0.00185mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|