ChemNet > CAS > 2351-37-3 Biphenyldicarbonylchloride
2351-37-3 Biphenyldicarbonylchloride
| product Name |
Biphenyldicarbonylchloride |
| CAS No |
2351-37-3 |
| Synonyms |
4,4-Biphenyldicarbonyl chloride; 4,4'-Biphenyldicarbonyl Chloride |
| Molecular Formula |
C14H8Cl2O2 |
| Molecular Weight |
279.1181 |
| InChI |
InChI=1/C14H8Cl2O2/c15-13(17)11-5-1-9(2-6-11)10-3-7-12(8-4-10)14(16)18/h1-8H |
| EINECS |
219-085-2 |
| Molecular Structure |
|
| Density |
1.344g/cm3 |
| Melting point |
184℃ |
| Boiling point |
407.8°C at 760 mmHg |
| Refractive index |
1.603 |
| Flash point |
224.1°C |
| Vapour Pressur |
7.35E-07mmHg at 25°C |
| Hazard Symbols |
 C:Corrosive;
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
| MSDS |
Material Safety Data Sheet
|
|
