ChemNet > CAS > 23513-72-6 5-oxo-L-proline, compound with 2-(dimethylamino)ethanol (1:1)
23513-72-6 5-oxo-L-proline, compound with 2-(dimethylamino)ethanol (1:1)
| product Name |
5-oxo-L-proline, compound with 2-(dimethylamino)ethanol (1:1) |
| CAS No |
23513-72-6 |
| Synonyms |
5-Oxo-L-proline, compound with 2-(dimethylamino)ethanol (1:1); 2-dimethylaminoethanol; (2S)-5-oxopyrrolidine-2-carboxylic acid |
| Molecular Formula |
C9H18N2O4 |
| Molecular Weight |
218.2502 |
| InChI |
InChI=1/C5H7NO3.C4H11NO/c7-4-2-1-3(6-4)5(8)9;1-5(2)3-4-6/h3H,1-2H2,(H,6,7)(H,8,9);6H,3-4H2,1-2H3/t3-;/m0./s1 |
| EINECS |
245-706-1 |
| Molecular Structure |
|
| Boiling point |
482.3°C at 760 mmHg |
| Flash point |
245.5°C |
| Vapour Pressur |
2.52E-11mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
