ChemNet > CAS > 23583-21-3 Benzylaminopropionicacidethylester
23583-21-3 Benzylaminopropionicacidethylester
| product Name |
Benzylaminopropionicacidethylester |
| CAS No |
23583-21-3 |
| Synonyms |
N-Benzyl-3-aminopropionic acid ethyl ester; N-Benzyl-beta-alanine ethyl ester; Bzl-beta-Ala-OEt~Ethyl 3-(benzylamino)propionate; ethyl N-benzyl-beta-alaninate; Ethyl 3-(Benzylamino)Propanoate |
| Molecular Formula |
C12H17NO2 |
| Molecular Weight |
207.2689 |
| InChI |
InChI=1/C12H17NO2/c1-2-15-12(14)8-9-13-10-11-6-4-3-5-7-11/h3-7,13H,2,8-10H2,1H3 |
| EINECS |
245-759-0 |
| Molecular Structure |
|
| Density |
1.033g/cm3 |
| Boiling point |
307.2°C at 760 mmHg |
| Refractive index |
1.507 |
| Flash point |
139.6°C |
| Vapour Pressur |
0.000737mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/38:Irritating to eyes and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
