ChemNet > CAS > 2362-62-1 4-Methyl(thiobenzamide)
2362-62-1 4-Methyl(thiobenzamide)
| product Name |
4-Methyl(thiobenzamide) |
| CAS No |
2362-62-1 |
| Synonyms |
4-methylbenzene-1-carbothioamide; 4-methylbenzenecarbothioamide |
| Molecular Formula |
C8H9NS |
| Molecular Weight |
151.2288 |
| InChI |
InChI=1/C8H9NS/c1-6-2-4-7(5-3-6)8(9)10/h2-5H,1H3,(H2,9,10) |
| Molecular Structure |
|
| Density |
1.143g/cm3 |
| Melting point |
166-169℃ |
| Boiling point |
258.9°C at 760 mmHg |
| Refractive index |
1.633 |
| Flash point |
110.4°C |
| Vapour Pressur |
0.0134mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
