ChemNet > CAS > 23780-13-4 (2-phenyl-1,3-thiazol-4-yl)methanol
23780-13-4 (2-phenyl-1,3-thiazol-4-yl)methanol
product Name |
(2-phenyl-1,3-thiazol-4-yl)methanol |
Synonyms |
(2-Phenyl-thiazol-4-yl)-methanol |
Molecular Formula |
C10H9NOS |
Molecular Weight |
191.2496 |
InChI |
InChI=1/C10H9NOS/c12-6-9-7-13-10(11-9)8-4-2-1-3-5-8/h1-5,7,12H,6H2 |
CAS Registry Number |
23780-13-4 |
Molecular Structure |
|
Density |
1.264g/cm3 |
Melting point |
67℃ |
Boiling point |
372.2°C at 760 mmHg |
Refractive index |
1.629 |
Flash point |
178.9°C |
Vapour Pressur |
3.37E-06mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
R24/25:Toxic in contact with skin and if swallowed.;
|
Safety Description |
|
|