ChemNet > CAS > 23806-24-8 3-Methylthiophene-2-carboxylic acid
23806-24-8 3-Methylthiophene-2-carboxylic acid
| product Name |
3-Methylthiophene-2-carboxylic acid |
| Synonyms |
3-Methyl-2-thiophenecarboxylic acid; 3-methylthiophene-2-carboxylate; RARECHEM AL BO 0517; 3-Methylthiophene-2-carboxylic |
| Molecular Formula |
C6H5O2S |
| Molecular Weight |
141.1682 |
| InChI |
InChI=1/C6H6O2S/c1-4-2-3-9-5(4)6(7)8/h2-3H,1H3,(H,7,8)/p-1 |
| CAS Registry Number |
23806-24-8 |
| EINECS |
245-894-5 |
| Molecular Structure |
|
| Melting point |
145-146℃ |
| Boiling point |
274°C at 760 mmHg |
| Flash point |
119.5°C |
| Vapour Pressur |
0.0027mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S24/25:;
|
| MSDS |
3-Methylthiophene-2-carboxylic acid Material Safety Data Sheet
|
|
