ChemNet > CAS > 2385-77-5 (+)-citronellal
2385-77-5 (+)-citronellal
| product Name |
(+)-citronellal |
| CAS No |
2385-77-5 |
| Synonyms |
(R)-(+)-Citronellal; (R)-(+)-3,7-Dimethyl-6-octenal |
| Molecular Formula |
C10H18O |
| Molecular Weight |
154.25 |
| InChI |
InChI=1/C10H18O/c1-9(2)5-4-6-10(3)7-8-11/h5,8,10H,4,6-7H2,1-3H3/t10-/m1/s1 |
| EINECS |
219-194-5 |
| Molecular Structure |
|
| Density |
0.8554 |
| Boiling point |
201-204℃ |
| Refractive index |
1.4467 |
| Flash point |
78℃ |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
