ChemNet > CAS > 2386-26-7 ethyl 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate
2386-26-7 ethyl 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate
| product Name |
ethyl 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate |
| CAS No |
2386-26-7 |
| Synonyms |
3-Acetyl-2,4-dimethyl-5-carbethoxypyrrole; 4-acetyl-3,5-dimethyl-1H-pyrrol-2-yl propanoate |
| Molecular Formula |
C11H15NO3 |
| Molecular Weight |
209.2417 |
| InChI |
InChI=1/C11H15NO3/c1-5-9(14)15-11-6(2)10(8(4)13)7(3)12-11/h12H,5H2,1-4H3 |
| Molecular Structure |
|
| Density |
1.125g/cm3 |
| Melting point |
139℃ |
| Boiling point |
348.9°C at 760 mmHg |
| Refractive index |
1.517 |
| Flash point |
164.8°C |
| Vapour Pressur |
4.89E-05mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
