ChemNet > CAS > 2387-23-7 N,N'-Dicyclohexylurea
2387-23-7 N,N'-Dicyclohexylurea
| product Name |
N,N'-Dicyclohexylurea |
| CAS No |
2387-23-7 |
| Synonyms |
N,N-Dicyclohexylurea; 1,3-dicyclohexylurea |
| Molecular Formula |
C13H24N2O |
| Molecular Weight |
224.3425 |
| InChI |
InChI=1/C13H24N2O/c16-13(14-11-7-3-1-4-8-11)15-12-9-5-2-6-10-12/h11-12H,1-10H2,(H2,14,15,16) |
| EINECS |
219-213-7 |
| Molecular Structure |
|
| Density |
1.02g/cm3 |
| Melting point |
231-235℃ |
| Boiling point |
408.2°C at 760 mmHg |
| Refractive index |
1.509 |
| Flash point |
157.9°C |
| Vapour Pressur |
7.15E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
