ChemNet > CAS > 239-35-0 1,2-benzodiphenylene sulfide
239-35-0 1,2-benzodiphenylene sulfide
| product Name |
1,2-benzodiphenylene sulfide |
| CAS No |
239-35-0 |
| Synonyms |
11-thiabenzo(a)fluorene; 1,2-benzo-9-thiafluorene; naphtho(1,2:2,3)thionaphthen; benzo[b]naphtho[2,1-d]thiophene |
| Molecular Formula |
C16H10S |
| Molecular Weight |
234.3156 |
| InChI |
InChI=1/C16H10S/c1-2-6-12-11(5-1)9-10-14-13-7-3-4-8-15(13)17-16(12)14/h1-10H |
| EINECS |
205-948-0 |
| Molecular Structure |
|
| Density |
1.292g/cm3 |
| Melting point |
188-190℃ |
| Boiling point |
434.3°C at 760 mmHg |
| Refractive index |
1.809 |
| Flash point |
163°C |
| Vapour Pressur |
2.44E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
