ChemNet > CAS > 2393-97-7 Bis-(4-chlorophenylthio)methane
2393-97-7 Bis-(4-chlorophenylthio)methane
| product Name |
Bis-(4-chlorophenylthio)methane |
| CAS No |
2393-97-7 |
| Synonyms |
Bis(4-chlorophenylthio)methane; 1,1'-(methanediyldisulfanediyl)bis(4-chlorobenzene) |
| Molecular Formula |
C13H10Cl2S2 |
| Molecular Weight |
301.2545 |
| InChI |
InChI=1/C13H10Cl2S2/c14-10-1-5-12(6-2-10)16-9-17-13-7-3-11(15)4-8-13/h1-8H,9H2 |
| Molecular Structure |
|
| Density |
1.38g/cm3 |
| Melting point |
45-48℃ |
| Boiling point |
420.9°C at 760 mmHg |
| Refractive index |
1.677 |
| Flash point |
192.5°C |
| Vapour Pressur |
6.64E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
