ChemNet > CAS > 2396-84-1 ethyl sorbate
2396-84-1 ethyl sorbate
| product Name |
ethyl sorbate |
| CAS No |
2396-84-1 |
| Synonyms |
Ethyl 2,4-hexadienoate~Sorbic acid ethyl ester; (E,E)-2,4-Hexadienoic acid ethylester; Ethyl trans,trans-2,4-hexadienoate; ethyl hexa-2,4-dienoate; ethyl (2E,4E)-hexa-2,4-dienoate; ethyl (2Z,4Z)-hexa-2,4-dienoate |
| Molecular Formula |
C8H12O2 |
| Molecular Weight |
140.1797 |
| InChI |
InChI=1/C8H12O2/c1-3-5-6-7-8(9)10-4-2/h3,5-7H,4H2,1-2H3/b5-3-,7-6- |
| EINECS |
219-258-2 |
| Molecular Structure |
|
| Density |
0.926g/cm3 |
| Boiling point |
195.5°C at 760 mmHg |
| Refractive index |
1.454 |
| Flash point |
69.4°C |
| Vapour Pressur |
0.418mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
