ChemNet > CAS > 2401-24-3 6-Chloro-m-anisidine
2401-24-3 6-Chloro-m-anisidine
| product Name |
6-Chloro-m-anisidine |
| CAS No |
2401-24-3 |
| Synonyms |
2-Chloro-5-methoxyaniline; 6-chloro-meta-anisidine; 3-Amino-4-chloroanisole |
| Molecular Formula |
C7H9Cl2NO |
| Molecular Weight |
194.0585 |
| InChI |
InChI=1/C7H8ClNO.ClH/c1-10-5-2-3-6(8)7(9)4-5;/h2-4H,9H2,1H3;1H |
| EINECS |
219-277-6 |
| Molecular Structure |
|
| Melting point |
207℃ |
| Boiling point |
255°C at 760 mmHg |
| Flash point |
108°C |
| Vapour Pressur |
0.0168mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S36/37:Wear suitable protective clothing and gloves.;
|
| MSDS |
Material Safety Data Sheet
|
|
