ChemNet > CAS > 24044-07-3 2-(2-thienyl)-1,3-thiazole-4-carboxylic acid
24044-07-3 2-(2-thienyl)-1,3-thiazole-4-carboxylic acid
| product Name |
2-(2-thienyl)-1,3-thiazole-4-carboxylic acid |
| CAS No |
24044-07-3 |
| Synonyms |
2-(thiophen-2-yl)thiazole-4-carboxylic acid; 2-(2-thienyl)thiazole-4-carboxylic acid; 2-thiophen-2-yl-1,3-thiazole-4-carboxylate |
| Molecular Formula |
C8H4NO2S2 |
| Molecular Weight |
210.2534 |
| InChI |
InChI=1/C8H5NO2S2/c10-8(11)5-4-13-7(9-5)6-2-1-3-12-6/h1-4H,(H,10,11)/p-1 |
| Molecular Structure |
|
| Melting point |
156℃ |
| Boiling point |
441.5°C at 760 mmHg |
| Flash point |
220.8°C |
| Vapour Pressur |
1.43E-08mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
