ChemNet > CAS > 2435-54-3 Tetrabromo-o-benzoquinone
2435-54-3 Tetrabromo-o-benzoquinone
| product Name |
Tetrabromo-o-benzoquinone |
| CAS No |
2435-54-3 |
| Synonyms |
o-Bromanil; 3,4,5,6-tetrabromocyclohexa-3,5-diene-1,2-dione |
| Molecular Formula |
C6Br4O2 |
| Molecular Weight |
423.679 |
| InChI |
InChI=1/C6Br4O2/c7-1-2(8)4(10)6(12)5(11)3(1)9 |
| EINECS |
219-426-5 |
| Molecular Structure |
|
| Density |
3.127g/cm3 |
| Melting point |
145-150℃ |
| Boiling point |
197.9°C at 760 mmHg |
| Refractive index |
1.806 |
| Flash point |
37.7°C |
| Vapour Pressur |
0.369mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S37:Wear suitable gloves.;
|
| MSDS |
Material Safety Data Sheet
|
|
