ChemNet > CAS > 2436-96-6 2,2'-Dinitrobiphenyl
2436-96-6 2,2'-Dinitrobiphenyl
| product Name |
2,2'-Dinitrobiphenyl |
| CAS No |
2436-96-6 |
| Synonyms |
2,2'-Dinitrobiphenyl, 2,2'-dinitro-; NSC 13356; 1,1'-Biphenyl, 2,2'-dinitro- (9CI); Biphenyl, 2,2'-dinitro- (8CI) |
| Molecular Formula |
C12H8N2O4 |
| Molecular Weight |
244.2029 |
| InChI |
InChI=1/C12H8N2O4/c15-13(16)11-7-3-1-5-9(11)10-6-2-4-8-12(10)14(17)18/h1-8H |
| EINECS |
219-435-4 |
| Molecular Structure |
|
| Density |
1.368g/cm3 |
| Melting point |
123-128℃ |
| Boiling point |
387.6°C at 760 mmHg |
| Refractive index |
1.635 |
| Flash point |
187.9°C |
| Vapour Pressur |
7.25E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
