ChemNet > CAS > 2438-10-0 (+)-Terpinen-4-ol
2438-10-0 (+)-Terpinen-4-ol
| product Name |
(+)-Terpinen-4-ol |
| CAS No |
2438-10-0 |
| Synonyms |
(+)-p-Menth-1-en-4-ol; (S)-4-Isopropyl-1-methyl-1-cyclohexen-4-ol; (1S)-4-methyl-1-(1-methylethyl)cyclohex-3-en-1-ol |
| Molecular Formula |
C10H18O |
| Molecular Weight |
154.2493 |
| InChI |
InChI=1/C10H18O/c1-8(2)10(11)6-4-9(3)5-7-10/h4,8,11H,5-7H2,1-3H3/t10-/m1/s1 |
| Molecular Structure |
|
| Density |
0.933g/cm3 |
| Boiling point |
209°C at 760 mmHg |
| Refractive index |
1.484 |
| Flash point |
79.4°C |
| Vapour Pressur |
0.0478mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
