ChemNet > CAS > 2439-83-0 1-Bromohexahydro-2H-azepin-2-one
2439-83-0 1-Bromohexahydro-2H-azepin-2-one
| product Name |
1-Bromohexahydro-2H-azepin-2-one |
| CAS No |
2439-83-0 |
| Synonyms |
N-Bromocaprolactam; 1-bromoazepan-2-one |
| Molecular Formula |
C6H10BrNO |
| Molecular Weight |
192.0537 |
| InChI |
InChI=1/C6H10BrNO/c7-8-5-3-1-2-4-6(8)9/h1-5H2 |
| EINECS |
219-466-3 |
| Molecular Structure |
|
| Density |
1.522g/cm3 |
| Boiling point |
220.9°C at 760 mmHg |
| Refractive index |
1.533 |
| Flash point |
87.4°C |
| Vapour Pressur |
0.111mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
