ChemNet > CAS > 24393-53-1 ethyl trans-4-bromocinnamate
24393-53-1 ethyl trans-4-bromocinnamate
| product Name |
ethyl trans-4-bromocinnamate |
| CAS No |
24393-53-1 |
| Synonyms |
2-Propenoic acid, 3-(4-bromophenyl)-, ethyl ester; NSC 636702; ethyl 3-(4-bromophenyl)prop-2-enoate; ethyl (2E)-3-(4-bromophenyl)prop-2-enoate |
| Molecular Formula |
C11H11BrO2 |
| Molecular Weight |
255.1078 |
| InChI |
InChI=1/C11H11BrO2/c1-2-14-11(13)8-5-9-3-6-10(12)7-4-9/h3-8H,2H2,1H3/b8-5+ |
| Molecular Structure |
|
| Density |
1.393g/cm3 |
| Boiling point |
308.6°C at 760 mmHg |
| Refractive index |
1.579 |
| Flash point |
150.8°C |
| Vapour Pressur |
0.000674mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
