ChemNet > CAS > 24437-41-0 1-Methyl-2-pyrroleacetonitrile
24437-41-0 1-Methyl-2-pyrroleacetonitrile
| product Name |
1-Methyl-2-pyrroleacetonitrile |
| CAS No |
24437-41-0 |
| Synonyms |
1-Methylpyrrole-2-acetonitrile; N-methylpyrrol-2-ylacetonitrile; (1-methyl-1H-pyrrol-2-yl)acetonitrile; 1-Methyl-1H-pyrrole-2-acetonitrile |
| Molecular Formula |
C7H8N2 |
| Molecular Weight |
120.1518 |
| InChI |
InChI=1/C7H8N2/c1-9-6-2-3-7(9)4-5-8/h2-3,6H,4H2,1H3 |
| EINECS |
246-248-5 |
| Molecular Structure |
|
| Density |
0.97g/cm3 |
| Melting point |
20℃ |
| Boiling point |
239.8°C at 760 mmHg |
| Refractive index |
1.528 |
| Flash point |
98.9°C |
| Vapour Pressur |
0.0392mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
