ChemNet > CAS > 2444-19-1 4-Hydroxyphenyl benzoate
2444-19-1 4-Hydroxyphenyl benzoate
| product Name |
4-Hydroxyphenyl benzoate |
| CAS No |
2444-19-1 |
| Synonyms |
Benzoic acid 4-hydroxyphenyl ester; Hydroquinone monobenzoate; Benzoicacid 4-hydroxyphenylester |
| Molecular Formula |
C13H10O3 |
| Molecular Weight |
214.2167 |
| InChI |
InChI=1/C13H10O3/c14-11-6-8-12(9-7-11)16-13(15)10-4-2-1-3-5-10/h1-9,14H |
| EINECS |
219-479-4 |
| Molecular Structure |
|
| Density |
1.25g/cm3 |
| Boiling point |
376.6°C at 760 mmHg |
| Refractive index |
1.615 |
| Flash point |
164.7°C |
| Vapour Pressur |
3.3E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
